About 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole
5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole (PubChem CID 112644967) has the molecular formula C15H19N3S
and a molecular weight of 273.40 g/mol. Its IUPAC name is 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole |
| PubChem CID | 112644967 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole |
| SMILES | c1ccc(C2CN(Cc3cncs3)CCCN2)cc1 |
| InChI | InChI=1S/C15H19N3S/c1-2-5-13(6-3-1)15-11-18(8-4-7-17-15)10-14-9-16-12-19-14/h1-3,5-6,9,12,15,17H,4,7-8,10-11H2 |
| InChIKey | HHYCPQLWZVJMAI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole?
The IUPAC name of 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole (CID 112644967) is 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole.
What is the SMILES notation for 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole?
The canonical SMILES for 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole is c1ccc(C2CN(Cc3cncs3)CCCN2)cc1.
What is the InChIKey of 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole?
The InChIKey is HHYCPQLWZVJMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3S/c1-2-5-13(6-3-1)15-11-18(8-4-7-17-15)10-14-9-16-12-19-14/h1-3,5-6,9,12,15,17H,4,7-8,10-11H2.
What are the key properties of 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole?
5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole has a molecular weight of 273.40 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-phenyl-1,4-diazepan-1-yl)methyl]-1,3-thiazole is sourced from PubChem (CID 112644967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).