C21H30ClN3O — CID 139811565
(3aS,7aR)-3-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]ethyl]-1,3,3a,4,5,6,7,7a-octahydroindol-2-one (PubChem CID 139811565) has the molecular formula C21H30ClN3O and a molecular weight of 375.94 g/mol. Its IUPAC name is (3aS,7aR)-3-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]ethyl]-1,3,3a,4,5,6,7,7a-octahydroindol-2-one.
| Compound Name | (3aS,7aR)-3-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]ethyl]-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
|---|---|
| PubChem CID | 139811565 |
| Molecular Formula | C21H30ClN3O |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (3aS,7aR)-3-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]ethyl]-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
| SMILES | O=C1N[C@@H]2CCCC[C@H]2C1CCN1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H30ClN3O/c22-17-5-3-4-16(14-17)15-25-12-10-24(11-13-25)9-8-19-18-6-1-2-7-20(18)23-21(19)26/h3-5,14,18-20H,1-2,6-13,15H2,(H,23,26)/t18-,19?,20+/m0/s1 |
| InChIKey | XSUIVBPZAOIPPH-SJBAFXMYSA-N |
| XLogP | 3.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |