C17H21ClN4O — CID 99628803
(4aS,7aS)-6-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 99628803) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is (4aS,7aS)-6-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 99628803 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (4aS,7aS)-6-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CN1CCO[C@H]2CN(Cc3cnn(-c4ccc(Cl)cc4)c3)C[C@@H]21 |
| InChI | InChI=1S/C17H21ClN4O/c1-20-6-7-23-17-12-21(11-16(17)20)9-13-8-19-22(10-13)15-4-2-14(18)3-5-15/h2-5,8,10,16-17H,6-7,9,11-12H2,1H3/t16-,17-/m0/s1 |
| InChIKey | GBOPXINLIRCRID-IRXDYDNUSA-N |
| XLogP | 2.04 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |