C18H23N3OS — CID 136583893
(4aS,7aR)-4-methyl-6-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 136583893) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is (4aS,7aR)-4-methyl-6-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aR)-4-methyl-6-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 136583893 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (4aS,7aR)-4-methyl-6-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cc1ncsc1-c1ccc(CN2C[C@H]3OCCN(C)[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H23N3OS/c1-13-18(23-12-19-13)15-5-3-14(4-6-15)9-21-10-16-17(11-21)22-8-7-20(16)2/h3-6,12,16-17H,7-11H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | DIQYWYFDBLHNKU-DLBZAZTESA-N |
| XLogP | 2.63 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |