C17H18ClN5O2 — CID 95122180
(9aR)-2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 95122180) has the molecular formula C17H18ClN5O2 and a molecular weight of 359.82 g/mol. Its IUPAC name is (9aR)-2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aR)-2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 95122180 |
| Molecular Formula | C17H18ClN5O2 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (9aR)-2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1NCC(=O)N2CCN(Cc3cnn(-c4ccc(Cl)cc4)c3)C[C@H]12 |
| InChI | InChI=1S/C17H18ClN5O2/c18-13-1-3-14(4-2-13)23-10-12(7-20-23)9-21-5-6-22-15(11-21)17(25)19-8-16(22)24/h1-4,7,10,15H,5-6,8-9,11H2,(H,19,25)/t15-/m1/s1 |
| InChIKey | JNCWXPGHGKCWQZ-OAHLLOKOSA-N |
| XLogP | 0.67 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |