C15H15F2N3O4 — CID 95141406
(9aR)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 95141406) has the molecular formula C15H15F2N3O4 and a molecular weight of 339.30 g/mol. Its IUPAC name is (9aR)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aR)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 95141406 |
| Molecular Formula | C15H15F2N3O4 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (9aR)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1NCC(=O)N2CCN(Cc3ccc4c(c3)OC(F)(F)O4)C[C@H]12 |
| InChI | InChI=1S/C15H15F2N3O4/c16-15(17)23-11-2-1-9(5-12(11)24-15)7-19-3-4-20-10(8-19)14(22)18-6-13(20)21/h1-2,5,10H,3-4,6-8H2,(H,18,22)/t10-/m1/s1 |
| InChIKey | HEOIUAFITGTOHW-SNVBAGLBSA-N |
| XLogP | 0.15 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |