C16H17F2NO5 — CID 154811694
(3aR,7aR)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 154811694) has the molecular formula C16H17F2NO5 and a molecular weight of 341.31 g/mol. Its IUPAC name is (3aR,7aR)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 154811694 |
| Molecular Formula | C16H17F2NO5 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (3aR,7aR)-2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@]12COCC[C@H]1CN(Cc1ccc3c(c1)OC(F)(F)O3)C2 |
| InChI | InChI=1S/C16H17F2NO5/c17-16(18)23-12-2-1-10(5-13(12)24-16)6-19-7-11-3-4-22-9-15(11,8-19)14(20)21/h1-2,5,11H,3-4,6-9H2,(H,20,21)/t11-,15+/m0/s1 |
| InChIKey | JTJGOODIYHLHOH-XHDPSFHLSA-N |
| XLogP | 1.93 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |