C20H20ClNO6 — CID 154812176
(3aR,7aR)-2-[[5-(3-carboxy-4-chlorophenyl)furan-2-yl]methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 154812176) has the molecular formula C20H20ClNO6 and a molecular weight of 405.83 g/mol. Its IUPAC name is (3aR,7aR)-2-[[5-(3-carboxy-4-chlorophenyl)furan-2-yl]methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[[5-(3-carboxy-4-chlorophenyl)furan-2-yl]methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 154812176 |
| Molecular Formula | C20H20ClNO6 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (3aR,7aR)-2-[[5-(3-carboxy-4-chlorophenyl)furan-2-yl]methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(CN3C[C@@H]4CCOC[C@]4(C(=O)O)C3)o2)ccc1Cl |
| InChI | InChI=1S/C20H20ClNO6/c21-16-3-1-12(7-15(16)18(23)24)17-4-2-14(28-17)9-22-8-13-5-6-27-11-20(13,10-22)19(25)26/h1-4,7,13H,5-6,8-11H2,(H,23,24)(H,25,26)/t13-,20+/m0/s1 |
| InChIKey | JAAALQRYKWIFRE-RNODOKPDSA-N |
| XLogP | 3.22 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |