C17H14F5NO8 — CID 171321422
(1S,5R)-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 171321422) has the molecular formula C17H14F5NO8 and a molecular weight of 455.29 g/mol. Its IUPAC name is (1S,5R)-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,5R)-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171321422 |
| Molecular Formula | C17H14F5NO8 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | (1S,5R)-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)[C@@]12CN(Cc3ccc4c(c3)OC(F)(F)O4)C[C@]1(C(=O)O)C2 |
| InChI | InChI=1S/C15H13F2NO6.C2HF3O2/c16-15(17)23-9-2-1-8(3-10(9)24-15)4-18-6-13(11(19)20)5-14(13,7-18)12(21)22;3-2(4,5)1(6)7/h1-3H,4-7H2,(H,19,20)(H,21,22);(H,6,7)/t13-,14+; |
| InChIKey | MCWNBIOJZPNHMT-KAECKJJSSA-N |
| XLogP | 2.00 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |