C17H16F5NO7 — CID 154918422
(1R,5S)-3-[(2,6-difluoro-4-methoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 154918422) has the molecular formula C17H16F5NO7 and a molecular weight of 441.31 g/mol. Its IUPAC name is (1R,5S)-3-[(2,6-difluoro-4-methoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (1R,5S)-3-[(2,6-difluoro-4-methoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154918422 |
| Molecular Formula | C17H16F5NO7 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | (1R,5S)-3-[(2,6-difluoro-4-methoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexane-1,5-dicarboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(F)c(CN2C[C@@]3(C(=O)O)C[C@@]3(C(=O)O)C2)c(F)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H15F2NO5.C2HF3O2/c1-23-8-2-10(16)9(11(17)3-8)4-18-6-14(12(19)20)5-15(14,7-18)13(21)22;3-2(4,5)1(6)7/h2-3H,4-7H2,1H3,(H,19,20)(H,21,22);(H,6,7)/t14-,15+; |
| InChIKey | RRFYZGOUOQNNOK-KBGJBQQCSA-N |
| XLogP | 1.97 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |