C19H26N4O2 — CID 95143453
(9aS)-2-[(3-methyl-4-pyrrolidin-1-ylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 95143453) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (9aS)-2-[(3-methyl-4-pyrrolidin-1-ylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aS)-2-[(3-methyl-4-pyrrolidin-1-ylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 95143453 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (9aS)-2-[(3-methyl-4-pyrrolidin-1-ylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | Cc1cc(CN2CCN3C(=O)CNC(=O)[C@@H]3C2)ccc1N1CCCC1 |
| InChI | InChI=1S/C19H26N4O2/c1-14-10-15(4-5-16(14)22-6-2-3-7-22)12-21-8-9-23-17(13-21)19(25)20-11-18(23)24/h4-5,10,17H,2-3,6-9,11-13H2,1H3,(H,20,25)/t17-/m0/s1 |
| InChIKey | HDSWRVDEIUBUBO-KRWDZBQOSA-N |
| XLogP | 0.74 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|