C19H22N4O3 — CID 95208621
(9aS)-2-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 95208621) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (9aS)-2-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aS)-2-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 95208621 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (9aS)-2-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | Cc1ccccc1-c1nc(CN2CCN3C(=O)CNC(=O)[C@@H]3C2)c(C)o1 |
| InChI | InChI=1S/C19H22N4O3/c1-12-5-3-4-6-14(12)19-21-15(13(2)26-19)10-22-7-8-23-16(11-22)18(25)20-9-17(23)24/h3-6,16H,7-11H2,1-2H3,(H,20,25)/t16-/m0/s1 |
| InChIKey | LLEUZTJUGHDIPK-INIZCTEOSA-N |
| XLogP | 1.10 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |