C23H29F2N3 — CID 46950614
(2R)-4-[(4-fluorophenyl)methyl]-1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]-2-methylpiperazine (PubChem CID 46950614) has the molecular formula C23H29F2N3 and a molecular weight of 385.50 g/mol. Its IUPAC name is (2R)-4-[(4-fluorophenyl)methyl]-1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]-2-methylpiperazine.
| Compound Name | (2R)-4-[(4-fluorophenyl)methyl]-1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 46950614 |
| Molecular Formula | C23H29F2N3 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (2R)-4-[(4-fluorophenyl)methyl]-1-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methyl]-2-methylpiperazine |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)CCN1Cc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C23H29F2N3/c1-18-15-26(16-19-4-7-21(24)8-5-19)12-13-28(18)17-20-6-9-23(22(25)14-20)27-10-2-3-11-27/h4-9,14,18H,2-3,10-13,15-17H2,1H3/t18-/m1/s1 |
| InChIKey | FPQYCQFKWNKIPI-GOSISDBHSA-N |
| XLogP | 4.27 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|