C18H25N5O — CID 134807385
N-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2-dimethylpyrrolo[3,2-c]pyridin-4-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 134807385) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2-dimethylpyrrolo[3,2-c]pyridin-4-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2-dimethylpyrrolo[3,2-c]pyridin-4-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 134807385 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | N-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2-dimethylpyrrolo[3,2-c]pyridin-4-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | Cc1noc(C)c1-c1cc2c(cc(C)n2C)c(NCCN(C)C)n1 |
| InChI | InChI=1S/C18H25N5O/c1-11-9-14-16(23(11)6)10-15(17-12(2)21-24-13(17)3)20-18(14)19-7-8-22(4)5/h9-10H,7-8H2,1-6H3,(H,19,20) |
| InChIKey | QOUFEXYMOQCYKC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|