C20H20N4O2 — CID 134809472
4-[4-(2-methoxy-4-pyridinyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 134809472) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-[4-(2-methoxy-4-pyridinyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[4-(2-methoxy-4-pyridinyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 134809472 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-[4-(2-methoxy-4-pyridinyl)-1,2-dimethylpyrrolo[3,2-c]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1cc(-c2nc(-c3c(C)noc3C)cc3c2cc(C)n3C)ccn1 |
| InChI | InChI=1S/C20H20N4O2/c1-11-8-15-17(24(11)4)10-16(19-12(2)23-26-13(19)3)22-20(15)14-6-7-21-18(9-14)25-5/h6-10H,1-5H3 |
| InChIKey | FFOCFXRFQNTFCQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|