C21H23N3O3 — CID 134808021
(3aR,6aS)-N-benzyl-5-[(2-methoxyphenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 134808021) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (3aR,6aS)-N-benzyl-5-[(2-methoxyphenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | (3aR,6aS)-N-benzyl-5-[(2-methoxyphenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 134808021 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (3aR,6aS)-N-benzyl-5-[(2-methoxyphenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | COc1ccccc1CN1C[C@@H]2C(C(=O)NCc3ccccc3)=NO[C@@H]2C1 |
| InChI | InChI=1S/C21H23N3O3/c1-26-18-10-6-5-9-16(18)12-24-13-17-19(14-24)27-23-20(17)21(25)22-11-15-7-3-2-4-8-15/h2-10,17,19H,11-14H2,1H3,(H,22,25)/t17-,19+/m0/s1 |
| InChIKey | ZAXOZHPRBCXTOU-PKOBYXMFSA-N |
| XLogP | 2.20 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |