About 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one
5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 134809490) has the molecular formula C24H30N2O3
and a molecular weight of 394.52 g/mol. Its IUPAC name is 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one |
| PubChem CID | 134809490 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | COc1cc2c(cc1Oc1ccccc1)NC(=O)C21CCN(CCC(C)C)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-17(2)9-12-26-13-10-24(11-14-26)19-15-21(28-3)22(16-20(19)25-23(24)27)29-18-7-5-4-6-8-18/h4-8,15-17H,9-14H2,1-3H3,(H,25,27) |
| InChIKey | WWSRHMYMNIWVJA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one?
The IUPAC name of 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one (CID 134809490) is 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one?
The canonical SMILES for 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one is COc1cc2c(cc1Oc1ccccc1)NC(=O)C21CCN(CCC(C)C)CC1.
What is the InChIKey of 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one?
The InChIKey is WWSRHMYMNIWVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O3/c1-17(2)9-12-26-13-10-24(11-14-26)19-15-21(28-3)22(16-20(19)25-23(24)27)29-18-7-5-4-6-8-18/h4-8,15-17H,9-14H2,1-3H3,(H,25,27).
What are the key properties of 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one?
5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one has a molecular weight of 394.52 g/mol, XLogP of 4.82, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1'-(3-methylbutyl)-6-phenoxyspiro[1H-indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 134809490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).