C26H27N3O4 — CID 134805477
1'-[(2-hydroxyphenyl)methyl]-5-methoxy-6-(pyridin-4-ylmethoxy)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 134805477) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1'-[(2-hydroxyphenyl)methyl]-5-methoxy-6-(pyridin-4-ylmethoxy)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-[(2-hydroxyphenyl)methyl]-5-methoxy-6-(pyridin-4-ylmethoxy)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 134805477 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1'-[(2-hydroxyphenyl)methyl]-5-methoxy-6-(pyridin-4-ylmethoxy)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | COc1cc2c(cc1OCc1ccncc1)NC(=O)C21CCN(Cc2ccccc2O)CC1 |
| InChI | InChI=1S/C26H27N3O4/c1-32-23-14-20-21(15-24(23)33-17-18-6-10-27-11-7-18)28-25(31)26(20)8-12-29(13-9-26)16-19-4-2-3-5-22(19)30/h2-7,10-11,14-15,30H,8-9,12-13,16-17H2,1H3,(H,28,31) |
| InChIKey | FAEVDTBXACJYKE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|