C25H30N4O2 — CID 134809501
N-[2-(1H-imidazol-5-yl)ethyl]-3-methyl-3-(4-phenylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide (PubChem CID 134809501) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-3-methyl-3-(4-phenylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-3-methyl-3-(4-phenylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 134809501 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-3-methyl-3-(4-phenylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide |
| SMILES | CC1(CCCCc2ccccc2)COc2ccc(C(=O)NCCc3cnc[nH]3)cc2N1 |
| InChI | InChI=1S/C25H30N4O2/c1-25(13-6-5-9-19-7-3-2-4-8-19)17-31-23-11-10-20(15-22(23)29-25)24(30)27-14-12-21-16-26-18-28-21/h2-4,7-8,10-11,15-16,18,29H,5-6,9,12-14,17H2,1H3,(H,26,28)(H,27,30) |
| InChIKey | ATMKXGHTRRZJSQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|