C23H23N3O4S — CID 134809922
CID 134809922 (PubChem CID 134809922) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol.
| Compound Name | CID 134809922 |
|---|---|
| PubChem CID | 134809922 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1cc(-c2ccc([S+](C)(=O)[O-])cc2)cc2c1OCCN2Cc1cccnc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-24-23(27)20-12-18(17-5-7-19(8-6-17)31(2,28)29)13-21-22(20)30-11-10-26(21)15-16-4-3-9-25-14-16/h3-9,12-14H,10-11,15H2,1-2H3,(H-,24,27,28,29) |
| InChIKey | QIMPQFQROYSPOE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|