C19H18F3N3O4S — CID 134810649
CID 134810649 (PubChem CID 134810649) has the molecular formula C19H18F3N3O4S and a molecular weight of 441.43 g/mol.
| Compound Name | CID 134810649 |
|---|---|
| PubChem CID | 134810649 |
| Molecular Formula | C19H18F3N3O4S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | — |
| SMILES | O=C1OCC2(CCN([S+](=O)([O-])c3ccc(C(F)(F)F)cc3)C2)N1Cc1ccccn1 |
| InChI | InChI=1S/C19H18F3N3O4S/c20-19(21,22)14-4-6-16(7-5-14)30(27,28)24-10-8-18(12-24)13-29-17(26)25(18)11-15-3-1-2-9-23-15/h1-7,9H,8,10-13H2 |
| InChIKey | DCPCOWGRIISRFV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|