C17H14F3N3O4S — CID 134794097
CID 134794097 (PubChem CID 134794097) has the molecular formula C17H14F3N3O4S and a molecular weight of 413.38 g/mol.
| Compound Name | CID 134794097 |
|---|---|
| PubChem CID | 134794097 |
| Molecular Formula | C17H14F3N3O4S |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | — |
| SMILES | O=C1Nc2cnccc2C2(CCN([S+](=O)([O-])c3cccc(C(F)(F)F)c3)C2)O1 |
| InChI | InChI=1S/C17H14F3N3O4S/c18-17(19,20)11-2-1-3-12(8-11)28(25,26)23-7-5-16(10-23)13-4-6-21-9-14(13)22-15(24)27-16/h1-4,6,8-9H,5,7,10H2,(H-,22,24,25,26) |
| InChIKey | NAQPKTHASPWXLV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|