C18H19F3N4O4S — CID 134787462
CID 134787462 (PubChem CID 134787462) has the molecular formula C18H19F3N4O4S and a molecular weight of 444.44 g/mol.
| Compound Name | CID 134787462 |
|---|---|
| PubChem CID | 134787462 |
| Molecular Formula | C18H19F3N4O4S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | — |
| SMILES | O=C(c1cnn2c1CN([S+](=O)([O-])c1cccc(C(F)(F)F)c1)CC2)N1CCOCC1 |
| InChI | InChI=1S/C18H19F3N4O4S/c19-18(20,21)13-2-1-3-14(10-13)30(27,28)24-4-5-25-16(12-24)15(11-22-25)17(26)23-6-8-29-9-7-23/h1-3,10-11H,4-9,12H2 |
| InChIKey | RCWVWQBCAKZMAR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|