C22H28F3N3O5S — CID 134796825
CID 134796825 (PubChem CID 134796825) has the molecular formula C22H28F3N3O5S and a molecular weight of 503.54 g/mol.
| Compound Name | CID 134796825 |
|---|---|
| PubChem CID | 134796825 |
| Molecular Formula | C22H28F3N3O5S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | — |
| SMILES | O=C(C1CCCN([S+](=O)([O-])c2cccc(C(F)(F)F)c2)C1)N1CCC(N2CCOCC2=O)CC1 |
| InChI | InChI=1S/C22H28F3N3O5S/c23-22(24,25)17-4-1-5-19(13-17)34(31,32)27-8-2-3-16(14-27)21(30)26-9-6-18(7-10-26)28-11-12-33-15-20(28)29/h1,4-5,13,16,18H,2-3,6-12,14-15H2 |
| InChIKey | OYYFWMYDNZJHLY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|