C20H27N3O4S — CID 134797050
CID 134797050 (PubChem CID 134797050) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol.
| Compound Name | CID 134797050 |
|---|---|
| PubChem CID | 134797050 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | — |
| SMILES | O=C(C1CCCN1[S+](=O)([O-])c1ccccc1)N1CCC(N2CCCC2=O)CC1 |
| InChI | InChI=1S/C20H27N3O4S/c24-19-9-5-12-22(19)16-10-14-21(15-11-16)20(25)18-8-4-13-23(18)28(26,27)17-6-2-1-3-7-17/h1-3,6-7,16,18H,4-5,8-15H2 |
| InChIKey | DCSKDQNFQOSONG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|