C20H27N3O5S — CID 134796365
CID 134796365 (PubChem CID 134796365) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol.
| Compound Name | CID 134796365 |
|---|---|
| PubChem CID | 134796365 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | — |
| SMILES | Cc1ccc([S+](=O)([O-])N2CCC[C@@H]2C(=O)N2CCC(N3CCOC3=O)CC2)cc1 |
| InChI | InChI=1S/C20H27N3O5S/c1-15-4-6-17(7-5-15)29(26,27)23-10-2-3-18(23)19(24)21-11-8-16(9-12-21)22-13-14-28-20(22)25/h4-7,16,18H,2-3,8-14H2,1H3/t18-/m1/s1 |
| InChIKey | IFJCMDSGNRPVIR-GOSISDBHSA-N |
| XLogP | 1.81 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|