C24H27F3N4O4S — CID 134797681
CID 134797681 (PubChem CID 134797681) has the molecular formula C24H27F3N4O4S and a molecular weight of 524.57 g/mol.
| Compound Name | CID 134797681 |
|---|---|
| PubChem CID | 134797681 |
| Molecular Formula | C24H27F3N4O4S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | — |
| SMILES | O=C(C1CCCN([S+](=O)([O-])c2cccc(C(F)(F)F)c2)C1)N1CCC(N2Cc3cccn3C2=O)CC1 |
| InChI | InChI=1S/C24H27F3N4O4S/c25-24(26,27)18-5-1-7-21(14-18)36(34,35)29-10-2-4-17(15-29)22(32)28-12-8-19(9-13-28)31-16-20-6-3-11-30(20)23(31)33/h1,3,5-7,11,14,17,19H,2,4,8-10,12-13,15-16H2 |
| InChIKey | PLHAODDKJGSUAZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|