C18H15F3N2O3S — CID 134791125
CID 134791125 (PubChem CID 134791125) has the molecular formula C18H15F3N2O3S and a molecular weight of 396.39 g/mol.
| Compound Name | CID 134791125 |
|---|---|
| PubChem CID | 134791125 |
| Molecular Formula | C18H15F3N2O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | — |
| SMILES | O=C1Nc2ccccc2CC12CN([S+](=O)([O-])c1cccc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C18H15F3N2O3S/c19-18(20,21)13-5-3-6-14(8-13)27(25,26)23-10-17(11-23)9-12-4-1-2-7-15(12)22-16(17)24/h1-8H,9-11H2,(H-,22,24,25,26) |
| InChIKey | QXKVFVVXCPDYHX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|