C19H27N3O5S2 — CID 134798320
CID 134798320 (PubChem CID 134798320) has the molecular formula C19H27N3O5S2 and a molecular weight of 441.58 g/mol.
| Compound Name | CID 134798320 |
|---|---|
| PubChem CID | 134798320 |
| Molecular Formula | C19H27N3O5S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | — |
| SMILES | O=C(C1CCCN([S+](=O)([O-])c2cccs2)C1)N1CCC(N2CCOCC2=O)CC1 |
| InChI | InChI=1S/C19H27N3O5S2/c23-17-14-27-11-10-22(17)16-5-8-20(9-6-16)19(24)15-3-1-7-21(13-15)29(25,26)18-4-2-12-28-18/h2,4,12,15-16H,1,3,5-11,13-14H2 |
| InChIKey | RPLOXUMWHTYNGB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|