C20H17ClF3N5O3S — CID 134787406
CID 134787406 (PubChem CID 134787406) has the molecular formula C20H17ClF3N5O3S and a molecular weight of 499.90 g/mol.
| Compound Name | CID 134787406 |
|---|---|
| PubChem CID | 134787406 |
| Molecular Formula | C20H17ClF3N5O3S |
| Molecular Weight | 499.90 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | — |
| SMILES | O=C(NCc1ccc(Cl)nc1)c1cn2c(n1)CN([S+](=O)([O-])c1cccc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C20H17ClF3N5O3S/c21-17-5-4-13(9-25-17)10-26-19(30)16-11-28-6-7-29(12-18(28)27-16)33(31,32)15-3-1-2-14(8-15)20(22,23)24/h1-5,8-9,11H,6-7,10,12H2,(H-,26,30,31,32) |
| InChIKey | LTYRIANCEZPNPB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|