C20H15Cl2F3N4O3S — CID 134788237
CID 134788237 (PubChem CID 134788237) has the molecular formula C20H15Cl2F3N4O3S and a molecular weight of 519.33 g/mol.
| Compound Name | CID 134788237 |
|---|---|
| PubChem CID | 134788237 |
| Molecular Formula | C20H15Cl2F3N4O3S |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cn2c(n1)CN([S+](=O)([O-])c1cccc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C20H15Cl2F3N4O3S/c21-13-4-5-16(15(22)9-13)27-19(30)17-10-28-6-7-29(11-18(28)26-17)33(31,32)14-3-1-2-12(8-14)20(23,24)25/h1-5,8-10H,6-7,11H2,(H-,27,30,31,32) |
| InChIKey | DPQDSSUHWRSLIQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|