C26H22F3N5O4S — CID 134798005
CID 134798005 (PubChem CID 134798005) has the molecular formula C26H22F3N5O4S and a molecular weight of 557.55 g/mol.
| Compound Name | CID 134798005 |
|---|---|
| PubChem CID | 134798005 |
| Molecular Formula | C26H22F3N5O4S |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | — |
| SMILES | O=C(c1nc2cccnc2n(Cc2ccccc2)c1=O)N1CCN([S+](=O)([O-])c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H22F3N5O4S/c27-26(28,29)19-8-4-9-20(16-19)39(37,38)33-14-12-32(13-15-33)24(35)22-25(36)34(17-18-6-2-1-3-7-18)23-21(31-22)10-5-11-30-23/h1-11,16H,12-15,17H2 |
| InChIKey | CQCPXPZPQVEOIS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|