C25H22FN5O2 — CID 53021557
4-benzyl-2-[4-(4-fluorobenzoyl)piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one (PubChem CID 53021557) has the molecular formula C25H22FN5O2 and a molecular weight of 443.48 g/mol. Its IUPAC name is 4-benzyl-2-[4-(4-fluorobenzoyl)piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 4-benzyl-2-[4-(4-fluorobenzoyl)piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 53021557 |
| Molecular Formula | C25H22FN5O2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-benzyl-2-[4-(4-fluorobenzoyl)piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCN(c2nc3cccnc3n(Cc3ccccc3)c2=O)CC1 |
| InChI | InChI=1S/C25H22FN5O2/c26-20-10-8-19(9-11-20)24(32)30-15-13-29(14-16-30)23-25(33)31(17-18-5-2-1-3-6-18)22-21(28-23)7-4-12-27-22/h1-12H,13-17H2 |
| InChIKey | AOQHSBZSPZPUES-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |