C27H27N5O3 — CID 53021537
4-benzyl-2-[4-(4-ethoxybenzoyl)piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one (PubChem CID 53021537) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 4-benzyl-2-[4-(4-ethoxybenzoyl)piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 4-benzyl-2-[4-(4-ethoxybenzoyl)piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 53021537 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-benzyl-2-[4-(4-ethoxybenzoyl)piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one |
| SMILES | CCOc1ccc(C(=O)N2CCN(c3nc4cccnc4n(Cc4ccccc4)c3=O)CC2)cc1 |
| InChI | InChI=1S/C27H27N5O3/c1-2-35-22-12-10-21(11-13-22)26(33)31-17-15-30(16-18-31)25-27(34)32(19-20-7-4-3-5-8-20)24-23(29-25)9-6-14-28-24/h3-14H,2,15-19H2,1H3 |
| InChIKey | WXDRDBCPBMEASU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |