C21H26N6O5S — CID 134795887
CID 134795887 (PubChem CID 134795887) has the molecular formula C21H26N6O5S and a molecular weight of 474.54 g/mol.
| Compound Name | CID 134795887 |
|---|---|
| PubChem CID | 134795887 |
| Molecular Formula | C21H26N6O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | — |
| SMILES | CCCCn1c(=O)c(C(=O)N2CCN([S+](=O)([O-])c3c(C)noc3C)CC2)nc2cccnc21 |
| InChI | InChI=1S/C21H26N6O5S/c1-4-5-9-27-19-16(7-6-8-22-19)23-17(21(27)29)20(28)25-10-12-26(13-11-25)33(30,31)18-14(2)24-32-15(18)3/h6-8H,4-5,9-13H2,1-3H3 |
| InChIKey | QCJIRWWLWCMWDV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 137.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|