C22H29N5O4 — CID 134800423
2-[4-(cyclopentanecarbonyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one (PubChem CID 134800423) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-[4-(cyclopentanecarbonyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 2-[4-(cyclopentanecarbonyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 134800423 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-[4-(cyclopentanecarbonyl)piperazine-1-carbonyl]-4-(3-methoxypropyl)pyrido[2,3-b]pyrazin-3-one |
| SMILES | COCCCn1c(=O)c(C(=O)N2CCN(C(=O)C3CCCC3)CC2)nc2cccnc21 |
| InChI | InChI=1S/C22H29N5O4/c1-31-15-5-10-27-19-17(8-4-9-23-19)24-18(22(27)30)21(29)26-13-11-25(12-14-26)20(28)16-6-2-3-7-16/h4,8-9,16H,2-3,5-7,10-15H2,1H3 |
| InChIKey | KJYRZLUMBKASTM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|