C16H20N4O3 — CID 134798713
N-(cyclopropylmethyl)-4-(3-methoxypropyl)-3-oxopyrido[2,3-b]pyrazine-2-carboxamide (PubChem CID 134798713) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-(3-methoxypropyl)-3-oxopyrido[2,3-b]pyrazine-2-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-4-(3-methoxypropyl)-3-oxopyrido[2,3-b]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 134798713 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(cyclopropylmethyl)-4-(3-methoxypropyl)-3-oxopyrido[2,3-b]pyrazine-2-carboxamide |
| SMILES | COCCCn1c(=O)c(C(=O)NCC2CC2)nc2cccnc21 |
| InChI | InChI=1S/C16H20N4O3/c1-23-9-3-8-20-14-12(4-2-7-17-14)19-13(16(20)22)15(21)18-10-11-5-6-11/h2,4,7,11H,3,5-6,8-10H2,1H3,(H,18,21) |
| InChIKey | OFULUVBKIWUKIP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|