C13H17N3O3S — CID 79289245
2-[3-(4-methoxybutyl)imidazo[4,5-b]pyridin-2-yl]sulfanylacetic acid (PubChem CID 79289245) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[3-(4-methoxybutyl)imidazo[4,5-b]pyridin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[3-(4-methoxybutyl)imidazo[4,5-b]pyridin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 79289245 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[3-(4-methoxybutyl)imidazo[4,5-b]pyridin-2-yl]sulfanylacetic acid |
| SMILES | COCCCCn1c(SCC(=O)O)nc2cccnc21 |
| InChI | InChI=1S/C13H17N3O3S/c1-19-8-3-2-7-16-12-10(5-4-6-14-12)15-13(16)20-9-11(17)18/h4-6H,2-3,7-9H2,1H3,(H,17,18) |
| InChIKey | VSELSKCDSHOJEF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|