C11H18N2O3S — CID 81336993
2-[1-(4-methoxybutyl)-5-methylimidazol-2-yl]sulfanylacetic acid (PubChem CID 81336993) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-[1-(4-methoxybutyl)-5-methylimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(4-methoxybutyl)-5-methylimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81336993 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-[1-(4-methoxybutyl)-5-methylimidazol-2-yl]sulfanylacetic acid |
| SMILES | COCCCCn1c(C)cnc1SCC(=O)O |
| InChI | InChI=1S/C11H18N2O3S/c1-9-7-12-11(17-8-10(14)15)13(9)5-3-4-6-16-2/h7H,3-6,8H2,1-2H3,(H,14,15) |
| InChIKey | MDGUZRLCIDMGTR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|