C11H16N2O4S — CID 81337247
2-[1-(3-ethoxy-3-oxopropyl)-5-methylimidazol-2-yl]sulfanylacetic acid (PubChem CID 81337247) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[1-(3-ethoxy-3-oxopropyl)-5-methylimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(3-ethoxy-3-oxopropyl)-5-methylimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81337247 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[1-(3-ethoxy-3-oxopropyl)-5-methylimidazol-2-yl]sulfanylacetic acid |
| SMILES | CCOC(=O)CCn1c(C)cnc1SCC(=O)O |
| InChI | InChI=1S/C11H16N2O4S/c1-3-17-10(16)4-5-13-8(2)6-12-11(13)18-7-9(14)15/h6H,3-5,7H2,1-2H3,(H,14,15) |
| InChIKey | OLYRQOAGARVVDL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |