C13H21N3O3S — CID 81337385
2-[5-methyl-1-(3-morpholin-4-ylpropyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81337385) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[5-methyl-1-(3-morpholin-4-ylpropyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-methyl-1-(3-morpholin-4-ylpropyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81337385 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[5-methyl-1-(3-morpholin-4-ylpropyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1cnc(SCC(=O)O)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C13H21N3O3S/c1-11-9-14-13(20-10-12(17)18)16(11)4-2-3-15-5-7-19-8-6-15/h9H,2-8,10H2,1H3,(H,17,18) |
| InChIKey | CZYZEPMTPKHCJT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |