C16H25N3O7 — CID 90486333
3,6-dimethyl-1-(4-morpholin-4-ylbutyl)pyrimidine-2,4-dione;oxalic acid (PubChem CID 90486333) has the molecular formula C16H25N3O7 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3,6-dimethyl-1-(4-morpholin-4-ylbutyl)pyrimidine-2,4-dione;oxalic acid.
| Compound Name | 3,6-dimethyl-1-(4-morpholin-4-ylbutyl)pyrimidine-2,4-dione;oxalic acid |
|---|---|
| PubChem CID | 90486333 |
| Molecular Formula | C16H25N3O7 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3,6-dimethyl-1-(4-morpholin-4-ylbutyl)pyrimidine-2,4-dione;oxalic acid |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCCN1CCOCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H23N3O3.C2H2O4/c1-12-11-13(18)15(2)14(19)17(12)6-4-3-5-16-7-9-20-10-8-16;3-1(4)2(5)6/h11H,3-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | BUQBORXMIIPTEM-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|