C23H26N4O3 — CID 134799498
4-(3-methoxypropyl)-2-(4-phenylpiperidine-1-carbonyl)pyrido[2,3-b]pyrazin-3-one (PubChem CID 134799498) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-2-(4-phenylpiperidine-1-carbonyl)pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 4-(3-methoxypropyl)-2-(4-phenylpiperidine-1-carbonyl)pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 134799498 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 4-(3-methoxypropyl)-2-(4-phenylpiperidine-1-carbonyl)pyrido[2,3-b]pyrazin-3-one |
| SMILES | COCCCn1c(=O)c(C(=O)N2CCC(c3ccccc3)CC2)nc2cccnc21 |
| InChI | InChI=1S/C23H26N4O3/c1-30-16-6-13-27-21-19(9-5-12-24-21)25-20(23(27)29)22(28)26-14-10-18(11-15-26)17-7-3-2-4-8-17/h2-5,7-9,12,18H,6,10-11,13-16H2,1H3 |
| InChIKey | IQTDRFQYTMCCHI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|