C22H27N3O3 — CID 134810836
4-benzyl-7-[(6-methoxy-3-pyridinyl)methyl]-3,5a,6,8,9,9a-hexahydro-2H-pyrido[3,4-f][1,4]oxazepin-5-one (PubChem CID 134810836) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-benzyl-7-[(6-methoxy-3-pyridinyl)methyl]-3,5a,6,8,9,9a-hexahydro-2H-pyrido[3,4-f][1,4]oxazepin-5-one.
| Compound Name | 4-benzyl-7-[(6-methoxy-3-pyridinyl)methyl]-3,5a,6,8,9,9a-hexahydro-2H-pyrido[3,4-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 134810836 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-benzyl-7-[(6-methoxy-3-pyridinyl)methyl]-3,5a,6,8,9,9a-hexahydro-2H-pyrido[3,4-f][1,4]oxazepin-5-one |
| SMILES | COc1ccc(CN2CCC3OCCN(Cc4ccccc4)C(=O)C3C2)cn1 |
| InChI | InChI=1S/C22H27N3O3/c1-27-21-8-7-18(13-23-21)14-24-10-9-20-19(16-24)22(26)25(11-12-28-20)15-17-5-3-2-4-6-17/h2-8,13,19-20H,9-12,14-16H2,1H3 |
| InChIKey | QZWGDGRNKOOYQZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |