C18H27N3O4 — CID 97419316
(5aR,9aR)-4-(2-methoxyethyl)-8-[(2-methoxy-3-pyridinyl)methyl]-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 97419316) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is (5aR,9aR)-4-(2-methoxyethyl)-8-[(2-methoxy-3-pyridinyl)methyl]-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aR,9aR)-4-(2-methoxyethyl)-8-[(2-methoxy-3-pyridinyl)methyl]-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 97419316 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (5aR,9aR)-4-(2-methoxyethyl)-8-[(2-methoxy-3-pyridinyl)methyl]-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | COCCN1CCO[C@H]2CN(Cc3cccnc3OC)CC[C@H]2C1=O |
| InChI | InChI=1S/C18H27N3O4/c1-23-10-8-21-9-11-25-16-13-20(7-5-15(16)18(21)22)12-14-4-3-6-19-17(14)24-2/h3-4,6,15-16H,5,7-13H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | CLGYLITZOSJQMR-CVEARBPZSA-N |
| XLogP | 0.79 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |