C16H21N7O — CID 134811040
N'-[3-(4-methoxy-2-pyridinyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 134811040) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is N'-[3-(4-methoxy-2-pyridinyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[3-(4-methoxy-2-pyridinyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 134811040 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N'-[3-(4-methoxy-2-pyridinyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | COc1ccnc(-c2nnc3ccc(N(C)CCN(C)C)nn23)c1 |
| InChI | InChI=1S/C16H21N7O/c1-21(2)9-10-22(3)15-6-5-14-18-19-16(23(14)20-15)13-11-12(24-4)7-8-17-13/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | BFZJNDNIKPLTFC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |