C9H7NO5 — CID 134813939
1,4,5,6-tetrahydroxy-2H-isoquinolin-3-one (PubChem CID 134813939) has the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. Its IUPAC name is 1,4,5,6-tetrahydroxy-2H-isoquinolin-3-one.
| Compound Name | 1,4,5,6-tetrahydroxy-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 134813939 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 1,4,5,6-tetrahydroxy-2H-isoquinolin-3-one |
| SMILES | O=c1[nH]c(O)c2ccc(O)c(O)c2c1O |
| InChI | InChI=1S/C9H7NO5/c11-4-2-1-3-5(6(4)12)7(13)9(15)10-8(3)14/h1-2,11-13H,(H2,10,14,15) |
| InChIKey | YIPRYIUCKYYUSM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|