C9H7NO3 — CID 54048310
1,5-dihydroxy-2H-isoquinolin-3-one (PubChem CID 54048310) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 1,5-dihydroxy-2H-isoquinolin-3-one.
| Compound Name | 1,5-dihydroxy-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 54048310 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 1,5-dihydroxy-2H-isoquinolin-3-one |
| SMILES | O=c1cc2c(O)cccc2c(O)[nH]1 |
| InChI | InChI=1S/C9H7NO3/c11-7-3-1-2-5-6(7)4-8(12)10-9(5)13/h1-4,11H,(H2,10,12,13) |
| InChIKey | LRCSNWPRWJNNIF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |