C16H18NNaO10S — CID 134814102
sodium N-[(2R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]sulfamate (PubChem CID 134814102) has the molecular formula C16H18NNaO10S and a molecular weight of 439.37 g/mol. Its IUPAC name is sodium N-[(2R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]sulfamate.
| Compound Name | sodium N-[(2R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]sulfamate |
|---|---|
| PubChem CID | 134814102 |
| Molecular Formula | C16H18NNaO10S |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | sodium N-[(2R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]sulfamate |
| SMILES | Cc1cc(=O)oc2cc(O[C@H]3OC(CO)[C@@H](O)C(O)C3NS(=O)(=O)[O-])ccc12.[Na+] |
| InChI | InChI=1S/C16H19NO10S.Na/c1-7-4-12(19)26-10-5-8(2-3-9(7)10)25-16-13(17-28(22,23)24)15(21)14(20)11(6-18)27-16;/h2-5,11,13-18,20-21H,6H2,1H3,(H,22,23,24);/q;+1/p-1/t11?,13?,14-,15?,16+;/m1./s1 |
| InChIKey | LMECUNAMBHBGFU-HSERJAKASA-M |
| XLogP | -4.66 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|