C18H21NO11S — CID 3356504
[5-acetamido-3,4-dihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 3356504) has the molecular formula C18H21NO11S and a molecular weight of 459.43 g/mol. Its IUPAC name is [5-acetamido-3,4-dihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [5-acetamido-3,4-dihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 3356504 |
| Molecular Formula | C18H21NO11S |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | [5-acetamido-3,4-dihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | CC(=O)NC1C(Oc2ccc3c(C)cc(=O)oc3c2)OC(COS(=O)(=O)O)C(O)C1O |
| InChI | InChI=1S/C18H21NO11S/c1-8-5-14(21)29-12-6-10(3-4-11(8)12)28-18-15(19-9(2)20)17(23)16(22)13(30-18)7-27-31(24,25)26/h3-6,13,15-18,22-23H,7H2,1-2H3,(H,19,20)(H,24,25,26) |
| InChIKey | FEMWMNCEGXUBRL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 181.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|